C26H37Cl2N3O5 — CID 21115034
1-(dimethylamino)ethyl (1R,15S,16S,20S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate;dihydrochloride (PubChem CID 21115034) has the molecular formula C26H37Cl2N3O5 and a molecular weight of 542.50 g/mol. Its IUPAC name is 1-(dimethylamino)ethyl (1R,15S,16S,20S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate;dihydrochloride.
| Compound Name | 1-(dimethylamino)ethyl (1R,15S,16S,20S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 21115034 |
| Molecular Formula | C26H37Cl2N3O5 |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 1-(dimethylamino)ethyl (1R,15S,16S,20S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaene-19-carboxylate;dihydrochloride |
| SMILES | COc1cc2[nH]c3c(c2cc1OC)CCN1C[C@H]2[C@H](C)OC=C(C(=O)OC(C)N(C)C)[C@H]2C[C@H]31.Cl.Cl |
| InChI | InChI=1S/C26H35N3O5.2ClH/c1-14-19-12-29-8-7-16-18-10-23(31-5)24(32-6)11-21(18)27-25(16)22(29)9-17(19)20(13-33-14)26(30)34-15(2)28(3)4;;/h10-11,13-15,17,19,22,27H,7-9,12H2,1-6H3;2*1H/t14-,15?,17-,19-,22+;;/m0../s1 |
| InChIKey | DEZNLMPEOKEZGF-YPQNVICTSA-N |
| XLogP | 4.32 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|