C23H28N2O5 — CID 57411249
[(16S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaen-19-yl] acetate (PubChem CID 57411249) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [(16S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaen-19-yl] acetate.
| Compound Name | [(16S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaen-19-yl] acetate |
|---|---|
| PubChem CID | 57411249 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [(16S)-6,7-dimethoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4,6,8,18-pentaen-19-yl] acetate |
| SMILES | COc1cc2[nH]c3c(c2cc1OC)CCN1CC2C(CC31)C(OC(C)=O)=CO[C@H]2C |
| InChI | InChI=1S/C23H28N2O5/c1-12-17-10-25-6-5-14-15-8-20(27-3)21(28-4)9-18(15)24-23(14)19(25)7-16(17)22(11-29-12)30-13(2)26/h8-9,11-12,16-17,19,24H,5-7,10H2,1-4H3/t12-,16?,17?,19?/m0/s1 |
| InChIKey | UBSFKTQYTDJRIZ-URUMGGPKSA-N |
| XLogP | 3.54 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|