C22H26N2O4 — CID 57411018
[(15R,16R)-6-methoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaen-19-yl] acetate (PubChem CID 57411018) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is [(15R,16R)-6-methoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaen-19-yl] acetate.
| Compound Name | [(15R,16R)-6-methoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaen-19-yl] acetate |
|---|---|
| PubChem CID | 57411018 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [(15R,16R)-6-methoxy-16-methyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,18-pentaen-19-yl] acetate |
| SMILES | COc1ccc2c3c([nH]c2c1)C1CC2C(OC(C)=O)=CO[C@H](C)[C@H]2CN1CC3 |
| InChI | InChI=1S/C22H26N2O4/c1-12-18-10-24-7-6-16-15-5-4-14(26-3)8-19(15)23-22(16)20(24)9-17(18)21(11-27-12)28-13(2)25/h4-5,8,11-12,17-18,20,23H,6-7,9-10H2,1-3H3/t12-,17?,18-,20?/m1/s1 |
| InChIKey | YRWVTQHOXFHJIY-AFSUZKOYSA-N |
| XLogP | 3.54 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|