C21H24N2O4 — CID 138502071
methyl (2S,3S,4R,5S)-5,16-dihydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate (PubChem CID 138502071) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (2S,3S,4R,5S)-5,16-dihydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate.
| Compound Name | methyl (2S,3S,4R,5S)-5,16-dihydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate |
|---|---|
| PubChem CID | 138502071 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (2S,3S,4R,5S)-5,16-dihydroxy-4-methyl-10,20-diazapentacyclo[11.7.0.02,10.03,7.014,19]icosa-1(13),8,14(19),15,17-pentaene-8-carboxylate |
| SMILES | COC(=O)C1=CN2CCc3c([nH]c4ccc(O)cc34)[C@@H]2[C@H]2C1C[C@H](O)[C@@H]2C |
| InChI | InChI=1S/C21H24N2O4/c1-10-17(25)8-14-15(21(26)27-2)9-23-6-5-12-13-7-11(24)3-4-16(13)22-19(12)20(23)18(10)14/h3-4,7,9-10,14,17-18,20,22,24-25H,5-6,8H2,1-2H3/t10-,14?,17-,18+,20-/m0/s1 |
| InChIKey | KZHPFSKJCVSIRI-GVPTVNFOSA-N |
| XLogP | 2.48 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|