C19H20N2O — CID 145496012
2-methyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol (PubChem CID 145496012) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-methyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol.
| Compound Name | 2-methyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 145496012 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-methyl-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
| SMILES | Cc1ccc(C2c3[nH]c4ccc(O)cc4c3CCN2C)cc1 |
| InChI | InChI=1S/C19H20N2O/c1-12-3-5-13(6-4-12)19-18-15(9-10-21(19)2)16-11-14(22)7-8-17(16)20-18/h3-8,11,19-20,22H,9-10H2,1-2H3 |
| InChIKey | OIFWHOQXDBIUTC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|