C25H21Cl2N3O — CID 20920912
6-chloro-N-(4-chlorophenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 20920912) has the molecular formula C25H21Cl2N3O and a molecular weight of 450.37 g/mol. Its IUPAC name is 6-chloro-N-(4-chlorophenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 6-chloro-N-(4-chlorophenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 20920912 |
| Molecular Formula | C25H21Cl2N3O |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 6-chloro-N-(4-chlorophenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | Cc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21Cl2N3O/c1-15-2-4-16(5-3-15)24-23-20(21-14-18(27)8-11-22(21)29-23)12-13-30(24)25(31)28-19-9-6-17(26)7-10-19/h2-11,14,24,29H,12-13H2,1H3,(H,28,31) |
| InChIKey | HCFSFNHCCYESTF-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|