C22H21ClFN3O3 — CID 92706550
ethyl 2-[[(1S)-6-chloro-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate (PubChem CID 92706550) has the molecular formula C22H21ClFN3O3 and a molecular weight of 429.88 g/mol. Its IUPAC name is ethyl 2-[[(1S)-6-chloro-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[(1S)-6-chloro-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 92706550 |
| Molecular Formula | C22H21ClFN3O3 |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | ethyl 2-[[(1S)-6-chloro-1-(4-fluorophenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21ClFN3O3/c1-2-30-19(28)12-25-22(29)27-10-9-16-17-11-14(23)5-8-18(17)26-20(16)21(27)13-3-6-15(24)7-4-13/h3-8,11,21,26H,2,9-10,12H2,1H3,(H,25,29)/t21-/m0/s1 |
| InChIKey | XVHYDGBGHWRTTL-NRFANRHFSA-N |
| XLogP | 4.18 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|