C23H24ClN3O3 — CID 92706557
ethyl 2-[[(1R)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate (PubChem CID 92706557) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is ethyl 2-[[(1R)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[(1R)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 92706557 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | ethyl 2-[[(1R)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)[C@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-3-30-20(28)13-25-23(29)27-11-10-17-18-12-16(24)8-9-19(18)26-21(17)22(27)15-6-4-14(2)5-7-15/h4-9,12,22,26H,3,10-11,13H2,1-2H3,(H,25,29)/t22-/m1/s1 |
| InChIKey | SDFNPTFNUYDSHY-JOCHJYFZSA-N |
| XLogP | 4.35 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|