C22H21ClN2O3 — CID 77457758
cyclopropylmethyl 6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 77457758) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is cyclopropylmethyl 6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | cyclopropylmethyl 6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 77457758 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | cyclopropylmethyl 6-chloro-1-(4-hydroxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OCC1CC1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C22H21ClN2O3/c23-15-5-8-19-18(11-15)17-9-10-25(22(27)28-12-13-1-2-13)21(20(17)24-19)14-3-6-16(26)7-4-14/h3-8,11,13,21,24,26H,1-2,9-10,12H2 |
| InChIKey | XPWJARORRUKYHG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|