C26H29ClN2O4 — CID 91015514
cyclopropylmethyl 6-chloro-1-[4-(4-hydroxybutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91015514) has the molecular formula C26H29ClN2O4 and a molecular weight of 468.98 g/mol. Its IUPAC name is cyclopropylmethyl 6-chloro-1-[4-(4-hydroxybutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | cyclopropylmethyl 6-chloro-1-[4-(4-hydroxybutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91015514 |
| Molecular Formula | C26H29ClN2O4 |
| Molecular Weight | 468.98 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | cyclopropylmethyl 6-chloro-1-[4-(4-hydroxybutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(OCC1CC1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCCCO)cc1 |
| InChI | InChI=1S/C26H29ClN2O4/c27-19-7-10-23-22(15-19)21-11-12-29(26(31)33-16-17-3-4-17)25(24(21)28-23)18-5-8-20(9-6-18)32-14-2-1-13-30/h5-10,15,17,25,28,30H,1-4,11-14,16H2 |
| InChIKey | KBRDPDSWTIKKPS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.98 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|