C31H35Cl2N3O3 — CID 158604351
(4-chlorophenyl) 6-chloro-1-[4-[4-(propan-2-ylamino)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate;molecular hydrogen (PubChem CID 158604351) has the molecular formula C31H35Cl2N3O3 and a molecular weight of 568.55 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-[4-(propan-2-ylamino)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate;molecular hydrogen.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-[4-(propan-2-ylamino)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 158604351 |
| Molecular Formula | C31H35Cl2N3O3 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-[4-(propan-2-ylamino)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate;molecular hydrogen |
| SMILES | CC(C)NCCCCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(Cl)cc2)cc1.[H][H] |
| InChI | InChI=1S/C31H33Cl2N3O3.H2/c1-20(2)34-16-3-4-18-38-24-10-5-21(6-11-24)30-29-26(27-19-23(33)9-14-28(27)35-29)15-17-36(30)31(37)39-25-12-7-22(32)8-13-25;/h5-14,19-20,30,34-35H,3-4,15-18H2,1-2H3;1H |
| InChIKey | HWALKHPGFWIRLQ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|