C30H29Cl2N3O5 — CID 77391939
(4-chlorophenyl) 1-[4-(4-acetamido-3-hydroxybutoxy)phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 77391939) has the molecular formula C30H29Cl2N3O5 and a molecular weight of 582.48 g/mol. Its IUPAC name is (4-chlorophenyl) 1-[4-(4-acetamido-3-hydroxybutoxy)phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 1-[4-(4-acetamido-3-hydroxybutoxy)phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 77391939 |
| Molecular Formula | C30H29Cl2N3O5 |
| Molecular Weight | 582.48 g/mol |
| Exact Mass | 581.15 |
| IUPAC Name | (4-chlorophenyl) 1-[4-(4-acetamido-3-hydroxybutoxy)phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(=O)NCC(O)CCOc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C30H29Cl2N3O5/c1-18(36)33-17-22(37)13-15-39-23-7-2-19(3-8-23)29-28-25(26-16-21(32)6-11-27(26)34-28)12-14-35(29)30(38)40-24-9-4-20(31)5-10-24/h2-11,16,22,29,34,37H,12-15,17H2,1H3,(H,33,36) |
| InChIKey | OTEZYOUNSJNIDY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.48 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|