C34H32Cl2N4O5 — CID 90902526
(4-chlorophenyl) 6-chloro-1-[4-[3-hydroxy-4-[[hydroxy(pyridin-4-yl)methyl]amino]butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 90902526) has the molecular formula C34H32Cl2N4O5 and a molecular weight of 647.56 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-[3-hydroxy-4-[[hydroxy(pyridin-4-yl)methyl]amino]butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-[3-hydroxy-4-[[hydroxy(pyridin-4-yl)methyl]amino]butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 90902526 |
| Molecular Formula | C34H32Cl2N4O5 |
| Molecular Weight | 647.56 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-[3-hydroxy-4-[[hydroxy(pyridin-4-yl)methyl]amino]butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | O=C(Oc1ccc(Cl)cc1)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCC(O)CNC(O)c2ccncc2)cc1 |
| InChI | InChI=1S/C34H32Cl2N4O5/c35-23-3-8-27(9-4-23)45-34(43)40-17-13-28-29-19-24(36)5-10-30(29)39-31(28)32(40)21-1-6-26(7-2-21)44-18-14-25(41)20-38-33(42)22-11-15-37-16-12-22/h1-12,15-16,19,25,32-33,38-39,41-42H,13-14,17-18,20H2 |
| InChIKey | MICBDBPBPFNOTM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.56 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|