C34H37ClIN3O5 — CID 88994908
[4-(1-iodoethyl)phenyl] (1S)-6-chloro-1-[4-(3-hydroxy-4-morpholin-4-ylbutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88994908) has the molecular formula C34H37ClIN3O5 and a molecular weight of 730.04 g/mol. Its IUPAC name is [4-(1-iodoethyl)phenyl] (1S)-6-chloro-1-[4-(3-hydroxy-4-morpholin-4-ylbutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | [4-(1-iodoethyl)phenyl] (1S)-6-chloro-1-[4-(3-hydroxy-4-morpholin-4-ylbutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88994908 |
| Molecular Formula | C34H37ClIN3O5 |
| Molecular Weight | 730.04 g/mol |
| Exact Mass | 729.15 |
| IUPAC Name | [4-(1-iodoethyl)phenyl] (1S)-6-chloro-1-[4-(3-hydroxy-4-morpholin-4-ylbutoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(I)c1ccc(OC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)[C@@H]2c2ccc(OCCC(O)CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C34H37ClIN3O5/c1-22(36)23-2-9-28(10-3-23)44-34(41)39-14-12-29-30-20-25(35)6-11-31(30)37-32(29)33(39)24-4-7-27(8-5-24)43-17-13-26(40)21-38-15-18-42-19-16-38/h2-11,20,22,26,33,37,40H,12-19,21H2,1H3/t22?,26?,33-/m0/s1 |
| InChIKey | ATPOEZYMFRMDLQ-XKGPBUNQSA-N |
| XLogP | 6.93 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.04 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|