C32H34ClN3O5 — CID 155172935
(3-methoxyphenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 155172935) has the molecular formula C32H34ClN3O5 and a molecular weight of 576.09 g/mol. Its IUPAC name is (3-methoxyphenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (3-methoxyphenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 155172935 |
| Molecular Formula | C32H34ClN3O5 |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | (3-methoxyphenyl) 6-chloro-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1cccc(OC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(OCCCN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C32H34ClN3O5/c1-38-25-4-2-5-26(21-25)41-32(37)36-14-12-27-28-20-23(33)8-11-29(28)34-30(27)31(36)22-6-9-24(10-7-22)40-17-3-13-35-15-18-39-19-16-35/h2,4-11,20-21,31,34H,3,12-19H2,1H3 |
| InChIKey | DRLNPAYZYASNPM-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|