C31H28Cl2N4O5 — CID 67986203
(4-chlorophenyl) 6-chloro-1-[4-[3-(3-methyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 67986203) has the molecular formula C31H28Cl2N4O5 and a molecular weight of 607.49 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-[3-(3-methyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-[3-(3-methyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 67986203 |
| Molecular Formula | C31H28Cl2N4O5 |
| Molecular Weight | 607.49 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-[3-(3-methyl-2,4-dioxoimidazolidin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CN1C(=O)CN(CCCOc2ccc(C3c4[nH]c5ccc(Cl)cc5c4CCN3C(=O)Oc3ccc(Cl)cc3)cc2)C1=O |
| InChI | InChI=1S/C31H28Cl2N4O5/c1-35-27(38)18-36(30(35)39)14-2-16-41-22-8-3-19(4-9-22)29-28-24(25-17-21(33)7-12-26(25)34-28)13-15-37(29)31(40)42-23-10-5-20(32)6-11-23/h3-12,17,29,34H,2,13-16,18H2,1H3 |
| InChIKey | NOQNAVISCDZGHJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|