C30H31ClN2O4 — CID 91312624
(4-propylphenyl) 6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91312624) has the molecular formula C30H31ClN2O4 and a molecular weight of 519.04 g/mol. Its IUPAC name is (4-propylphenyl) 6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-propylphenyl) 6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91312624 |
| Molecular Formula | C30H31ClN2O4 |
| Molecular Weight | 519.04 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (4-propylphenyl) 6-chloro-1-[4-(3-hydroxypropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCCc1ccc(OC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(OCCCO)cc2)cc1 |
| InChI | InChI=1S/C30H31ClN2O4/c1-2-4-20-5-10-24(11-6-20)37-30(35)33-16-15-25-26-19-22(31)9-14-27(26)32-28(25)29(33)21-7-12-23(13-8-21)36-18-3-17-34/h5-14,19,29,32,34H,2-4,15-18H2,1H3 |
| InChIKey | KGZDXDIMRRPIFR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 74.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.04 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|