C33H32Cl2N4O3 — CID 91466404
(4-chlorophenyl) 6-chloro-1-[4-[3-(5-methyl-4,5-dihydrodiazepin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91466404) has the molecular formula C33H32Cl2N4O3 and a molecular weight of 603.55 g/mol. Its IUPAC name is (4-chlorophenyl) 6-chloro-1-[4-[3-(5-methyl-4,5-dihydrodiazepin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-chloro-1-[4-[3-(5-methyl-4,5-dihydrodiazepin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91466404 |
| Molecular Formula | C33H32Cl2N4O3 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | (4-chlorophenyl) 6-chloro-1-[4-[3-(5-methyl-4,5-dihydrodiazepin-1-yl)propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC1C=CN(CCCOc2ccc(C3c4[nH]c5ccc(Cl)cc5c4CCN3C(=O)Oc3ccc(Cl)cc3)cc2)N=CC1 |
| InChI | InChI=1S/C33H32Cl2N4O3/c1-22-13-16-36-38(18-14-22)17-2-20-41-26-8-3-23(4-9-26)32-31-28(29-21-25(35)7-12-30(29)37-31)15-19-39(32)33(40)42-27-10-5-24(34)6-11-27/h3-12,14,16,18,21-22,32,37H,2,13,15,17,19-20H2,1H3 |
| InChIKey | RHUANLYVAIPASY-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|