C35H33ClN4O5 — CID 155000689
(4-chlorophenyl) (1S)-1-[4-[3-hydroxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 155000689) has the molecular formula C35H33ClN4O5 and a molecular weight of 625.13 g/mol. Its IUPAC name is (4-chlorophenyl) (1S)-1-[4-[3-hydroxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) (1S)-1-[4-[3-hydroxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 155000689 |
| Molecular Formula | C35H33ClN4O5 |
| Molecular Weight | 625.13 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | (4-chlorophenyl) (1S)-1-[4-[3-hydroxy-4-(pyridine-2-carbonylamino)butoxy]phenyl]-6-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C(=O)Oc1ccc(Cl)cc1)[C@H]3c1ccc(OCCC(O)CNC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C35H33ClN4O5/c1-22-5-14-30-29(20-22)28-15-18-40(35(43)45-27-12-8-24(36)9-13-27)33(32(28)39-30)23-6-10-26(11-7-23)44-19-16-25(41)21-38-34(42)31-4-2-3-17-37-31/h2-14,17,20,25,33,39,41H,15-16,18-19,21H2,1H3,(H,38,42)/t25?,33-/m0/s1 |
| InChIKey | QYGXIMDOXFFZHF-ZEWJHAJUSA-N |
| XLogP | 6.23 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.13 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|