C20H20Cl2N3O3+ — CID 143535953
[4-[6-chloro-2-(2-chloroethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-hydroxyazanium (PubChem CID 143535953) has the molecular formula C20H20Cl2N3O3+ and a molecular weight of 421.30 g/mol. Its IUPAC name is [4-[6-chloro-2-(2-chloroethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-hydroxyazanium.
| Compound Name | [4-[6-chloro-2-(2-chloroethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-hydroxyazanium |
|---|---|
| PubChem CID | 143535953 |
| Molecular Formula | C20H20Cl2N3O3+ |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | [4-[6-chloro-2-(2-chloroethoxycarbonyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-hydroxyazanium |
| SMILES | O=C(OCCCl)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc([NH2+]O)cc1 |
| InChI | InChI=1S/C20H19Cl2N3O3/c21-8-10-28-20(26)25-9-7-15-16-11-13(22)3-6-17(16)23-18(15)19(25)12-1-4-14(24-27)5-2-12/h1-6,11,19,23-24,27H,7-10H2/p+1 |
| InChIKey | FHJRILGSQMWUEN-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|