C29H35ClN2O5 — CID 77457769
(1-methylcyclopropyl)methyl 1-[4-[2,2-bis(hydroxymethyl)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 77457769) has the molecular formula C29H35ClN2O5 and a molecular weight of 527.06 g/mol. Its IUPAC name is (1-methylcyclopropyl)methyl 1-[4-[2,2-bis(hydroxymethyl)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (1-methylcyclopropyl)methyl 1-[4-[2,2-bis(hydroxymethyl)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 77457769 |
| Molecular Formula | C29H35ClN2O5 |
| Molecular Weight | 527.06 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (1-methylcyclopropyl)methyl 1-[4-[2,2-bis(hydroxymethyl)butoxy]phenyl]-6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCC(CO)(CO)COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)OCC2(C)CC2)cc1 |
| InChI | InChI=1S/C29H35ClN2O5/c1-3-29(15-33,16-34)18-36-21-7-4-19(5-8-21)26-25-22(23-14-20(30)6-9-24(23)31-25)10-13-32(26)27(35)37-17-28(2)11-12-28/h4-9,14,26,31,33-34H,3,10-13,15-18H2,1-2H3 |
| InChIKey | YIQMNJHUXNBKCS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.06 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|