C28H33ClN2O5 — CID 75288820
propyl 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 75288820) has the molecular formula C28H33ClN2O5 and a molecular weight of 513.03 g/mol. Its IUPAC name is propyl 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | propyl 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 75288820 |
| Molecular Formula | C28H33ClN2O5 |
| Molecular Weight | 513.03 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | propyl 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCCOC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCC2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C28H33ClN2O5/c1-4-14-34-27(32)31-13-11-22-23-16-19(29)7-10-24(23)30-25(22)26(31)18-5-8-20(9-6-18)33-15-12-21-17-35-28(2,3)36-21/h5-10,16,21,26,30H,4,11-15,17H2,1-3H3 |
| InChIKey | UAKIEUAGVJDULG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 73.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.03 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|