C31H32ClN3O5 — CID 91116831
(4-aminophenyl) 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91116831) has the molecular formula C31H32ClN3O5 and a molecular weight of 562.07 g/mol. Its IUPAC name is (4-aminophenyl) 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-aminophenyl) 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91116831 |
| Molecular Formula | C31H32ClN3O5 |
| Molecular Weight | 562.07 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | (4-aminophenyl) 6-chloro-1-[4-[2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC1(C)OCC(CCOc2ccc(C3c4[nH]c5ccc(Cl)cc5c4CCN3C(=O)Oc3ccc(N)cc3)cc2)O1 |
| InChI | InChI=1S/C31H32ClN3O5/c1-31(2)38-18-24(40-31)14-16-37-22-8-3-19(4-9-22)29-28-25(26-17-20(32)5-12-27(26)34-28)13-15-35(29)30(36)39-23-10-6-21(33)7-11-23/h3-12,17,24,29,34H,13-16,18,33H2,1-2H3 |
| InChIKey | REDMCLKQDOQHQK-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 99.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.07 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|