C29H30ClN5O3 — CID 88995001
(4-chlorophenyl) 6-amino-1-[4-[3-[[(Z)-2-aminoethenyl]amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 88995001) has the molecular formula C29H30ClN5O3 and a molecular weight of 532.04 g/mol. Its IUPAC name is (4-chlorophenyl) 6-amino-1-[4-[3-[[(Z)-2-aminoethenyl]amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-chlorophenyl) 6-amino-1-[4-[3-[[(Z)-2-aminoethenyl]amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 88995001 |
| Molecular Formula | C29H30ClN5O3 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (4-chlorophenyl) 6-amino-1-[4-[3-[[(Z)-2-aminoethenyl]amino]propoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | N/C=C\NCCCOc1ccc(C2c3[nH]c4ccc(N)cc4c3CCN2C(=O)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H30ClN5O3/c30-20-4-9-23(10-5-20)38-29(36)35-16-12-24-25-18-21(32)6-11-26(25)34-27(24)28(35)19-2-7-22(8-3-19)37-17-1-14-33-15-13-31/h2-11,13,15,18,28,33-34H,1,12,14,16-17,31-32H2/b15-13- |
| InChIKey | ZVAYAWKVKDPGBB-SQFISAMPSA-N |
| XLogP | 5.34 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|