C14H19N3 — CID 82391010
(2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine (PubChem CID 82391010) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is (2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine.
| Compound Name | (2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine |
|---|---|
| PubChem CID | 82391010 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (2,6-dimethyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)methanamine |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C)C3CN |
| InChI | InChI=1S/C14H19N3/c1-9-3-4-12-11(7-9)10-5-6-17(2)13(8-15)14(10)16-12/h3-4,7,13,16H,5-6,8,15H2,1-2H3 |
| InChIKey | VKKZPDSMIWOHFX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|