C15H18N2 — CID 66612137
2-cyclopropyl-8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 66612137) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-cyclopropyl-8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 2-cyclopropyl-8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 66612137 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-cyclopropyl-8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CN(C1CC1)CC3 |
| InChI | InChI=1S/C15H18N2/c1-10-2-5-14-12(8-10)13-9-17(11-3-4-11)7-6-15(13)16-14/h2,5,8,11,16H,3-4,6-7,9H2,1H3 |
| InChIKey | CFFNISZFOSHXKX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|