C24H32N4O3 — CID 143647961
ethyl 3-(2-cyclopentyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)-1,3-diazinane-1-carboxylate (PubChem CID 143647961) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is ethyl 3-(2-cyclopentyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)-1,3-diazinane-1-carboxylate.
| Compound Name | ethyl 3-(2-cyclopentyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 143647961 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | ethyl 3-(2-cyclopentyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carbonyl)-1,3-diazinane-1-carboxylate |
| SMILES | CCOC(=O)N1CCCN(C(=O)c2ccc3[nH]c4c(c3c2)CN(C2CCCC2)CC4)C1 |
| InChI | InChI=1S/C24H32N4O3/c1-2-31-24(30)28-12-5-11-27(16-28)23(29)17-8-9-21-19(14-17)20-15-26(13-10-22(20)25-21)18-6-3-4-7-18/h8-9,14,18,25H,2-7,10-13,15-16H2,1H3 |
| InChIKey | UYJACZMDIOAYTQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|