C20H18N2O3 — CID 145496118
1-(furan-3-yl)-2-(furan-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol (PubChem CID 145496118) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-(furan-3-yl)-2-(furan-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol.
| Compound Name | 1-(furan-3-yl)-2-(furan-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
|---|---|
| PubChem CID | 145496118 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-(furan-3-yl)-2-(furan-2-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-6-ol |
| SMILES | Oc1ccc2[nH]c3c(c2c1)CCN(Cc1ccco1)C3c1ccoc1 |
| InChI | InChI=1S/C20H18N2O3/c23-14-3-4-18-17(10-14)16-5-7-22(11-15-2-1-8-25-15)20(19(16)21-18)13-6-9-24-12-13/h1-4,6,8-10,12,20-21,23H,5,7,11H2 |
| InChIKey | ORKMPPSQOCDLFN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|