C25H26N2O3 — CID 45242680
[5-[[1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol (PubChem CID 45242680) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is [5-[[1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 45242680 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [5-[[1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol |
| SMILES | COc1ccc(C2c3[nH]c4ccccc4c3CCN2Cc2ccc(CO)o2)cc1C |
| InChI | InChI=1S/C25H26N2O3/c1-16-13-17(7-10-23(16)29-2)25-24-21(20-5-3-4-6-22(20)26-24)11-12-27(25)14-18-8-9-19(15-28)30-18/h3-10,13,25-26,28H,11-12,14-15H2,1-2H3 |
| InChIKey | GEYCRQNVATTYPN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|