C23H22N2O2 — CID 42121851
1-[(1S)-1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-yn-1-one (PubChem CID 42121851) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-[(1S)-1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-yn-1-one.
| Compound Name | 1-[(1S)-1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 42121851 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[(1S)-1-(4-methoxy-3-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1CCc2c([nH]c3ccccc23)[C@@H]1c1ccc(OC)c(C)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-4-7-21(26)25-13-12-18-17-8-5-6-9-19(17)24-22(18)23(25)16-10-11-20(27-3)15(2)14-16/h5-6,8-11,14,23-24H,12-13H2,1-3H3/t23-/m0/s1 |
| InChIKey | JBFWSJNVCXDGDR-QHCPKHFHSA-N |
| XLogP | 3.98 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|