C27H26N2O3S — CID 92730449
(3,4-dimethoxyphenyl)-[(1R)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 92730449) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[(1R)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (3,4-dimethoxyphenyl)-[(1R)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 92730449 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[(1R)-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCc3c([nH]c4ccccc34)[C@H]2c2ccc(SC)cc2)cc1OC |
| InChI | InChI=1S/C27H26N2O3S/c1-31-23-13-10-18(16-24(23)32-2)27(30)29-15-14-21-20-6-4-5-7-22(20)28-25(21)26(29)17-8-11-19(33-3)12-9-17/h4-13,16,26,28H,14-15H2,1-3H3/t26-/m1/s1 |
| InChIKey | KSBUHMJWWHHMIZ-AREMUKBSSA-N |
| XLogP | 5.69 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|