C25H26N2O3 — CID 45174023
2-[[5-(methoxymethyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 45174023) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[[5-(methoxymethyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[[5-(methoxymethyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 45174023 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[[5-(methoxymethyl)furan-2-yl]methyl]-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COCc1ccc(CN2CCc3c([nH]c4ccccc34)C2c2ccccc2OC)o1 |
| InChI | InChI=1S/C25H26N2O3/c1-28-16-18-12-11-17(30-18)15-27-14-13-20-19-7-3-5-9-22(19)26-24(20)25(27)21-8-4-6-10-23(21)29-2/h3-12,25-26H,13-16H2,1-2H3 |
| InChIKey | NGCZHAXOVIDFIL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 50.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|