C27H28N2O3 — CID 25304414
2-[3-[[(1R)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol (PubChem CID 25304414) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[3-[[(1R)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[3-[[(1R)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 25304414 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 2-[3-[[(1R)-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol |
| SMILES | COc1ccccc1[C@@H]1c2[nH]c3ccccc3c2CCN1Cc1cccc(OCCO)c1 |
| InChI | InChI=1S/C27H28N2O3/c1-31-25-12-5-3-10-23(25)27-26-22(21-9-2-4-11-24(21)28-26)13-14-29(27)18-19-7-6-8-20(17-19)32-16-15-30/h2-12,17,27-28,30H,13-16,18H2,1H3/t27-/m1/s1 |
| InChIKey | SCONMCJAVGMQLX-HHHXNRCGSA-N |
| XLogP | 4.70 |
| TPSA | 57.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|