C23H23N3O2S — CID 45171284
2-[[1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-thiazole (PubChem CID 45171284) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[[1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 45171284 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[[1-(2,3-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]-1,3-thiazole |
| SMILES | COc1cccc(C2c3[nH]c4ccccc4c3CCN2Cc2nccs2)c1OC |
| InChI | InChI=1S/C23H23N3O2S/c1-27-19-9-5-7-17(23(19)28-2)22-21-16(15-6-3-4-8-18(15)25-21)10-12-26(22)14-20-24-11-13-29-20/h3-9,11,13,22,25H,10,12,14H2,1-2H3 |
| InChIKey | YTEBOOZBUDCQQT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|