C15H19N3OS — CID 124943474
2-[[(2R)-2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole (PubChem CID 124943474) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[[(2R)-2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(2R)-2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 124943474 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[[(2R)-2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole |
| SMILES | COc1ccccc1[C@@H]1CNCCN1Cc1nccs1 |
| InChI | InChI=1S/C15H19N3OS/c1-19-14-5-3-2-4-12(14)13-10-16-6-8-18(13)11-15-17-7-9-20-15/h2-5,7,9,13,16H,6,8,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | BCTLXZPJGMTFRS-ZDUSSCGKSA-N |
| XLogP | 2.30 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |