C17H23N3OS — CID 120767480
5-ethyl-2-[[2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole (PubChem CID 120767480) has the molecular formula C17H23N3OS and a molecular weight of 317.46 g/mol. Its IUPAC name is 5-ethyl-2-[[2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole.
| Compound Name | 5-ethyl-2-[[2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 120767480 |
| Molecular Formula | C17H23N3OS |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 5-ethyl-2-[[2-(2-methoxyphenyl)piperazin-1-yl]methyl]-1,3-thiazole |
| SMILES | CCc1cnc(CN2CCNCC2c2ccccc2OC)s1 |
| InChI | InChI=1S/C17H23N3OS/c1-3-13-10-19-17(22-13)12-20-9-8-18-11-15(20)14-6-4-5-7-16(14)21-2/h4-7,10,15,18H,3,8-9,11-12H2,1-2H3 |
| InChIKey | OXEJNKOMYKNKRM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |