C21H25ClN4O — CID 120767617
2-(2-methoxyphenyl)-1-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine;hydrochloride (PubChem CID 120767617) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120767617 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-[(2-phenyl-1H-imidazol-5-yl)methyl]piperazine;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1Cc1cnc(-c2ccccc2)[nH]1.Cl |
| InChI | InChI=1S/C21H24N4O.ClH/c1-26-20-10-6-5-9-18(20)19-14-22-11-12-25(19)15-17-13-23-21(24-17)16-7-3-2-4-8-16;/h2-10,13,19,22H,11-12,14-15H2,1H3,(H,23,24);1H |
| InChIKey | MEGYJLVRPSYTGF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |