C15H21ClN4O — CID 120767431
2-(2-methoxyphenyl)-1-(1H-pyrazol-5-ylmethyl)piperazine;hydrochloride (PubChem CID 120767431) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-(1H-pyrazol-5-ylmethyl)piperazine;hydrochloride.
| Compound Name | 2-(2-methoxyphenyl)-1-(1H-pyrazol-5-ylmethyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120767431 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-(1H-pyrazol-5-ylmethyl)piperazine;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1Cc1ccn[nH]1.Cl |
| InChI | InChI=1S/C15H20N4O.ClH/c1-20-15-5-3-2-4-13(15)14-10-16-8-9-19(14)11-12-6-7-17-18-12;/h2-7,14,16H,8-11H2,1H3,(H,17,18);1H |
| InChIKey | FPVJBFRTKDEIMJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |