C27H23FN4O — CID 25298584
(1S)-1-(4-fluoro-3-methoxyphenyl)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 25298584) has the molecular formula C27H23FN4O and a molecular weight of 438.51 g/mol. Its IUPAC name is (1S)-1-(4-fluoro-3-methoxyphenyl)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-1-(4-fluoro-3-methoxyphenyl)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 25298584 |
| Molecular Formula | C27H23FN4O |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (1S)-1-(4-fluoro-3-methoxyphenyl)-2-(quinoxalin-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1cc([C@H]2c3[nH]c4ccccc4c3CCN2Cc2cccc3nccnc23)ccc1F |
| InChI | InChI=1S/C27H23FN4O/c1-33-24-15-17(9-10-21(24)28)27-26-20(19-6-2-3-7-22(19)31-26)11-14-32(27)16-18-5-4-8-23-25(18)30-13-12-29-23/h2-10,12-13,15,27,31H,11,14,16H2,1H3/t27-/m0/s1 |
| InChIKey | FBOUNCXRBXMTDX-MHZLTWQESA-N |
| XLogP | 5.41 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|