C24H24N4OS — CID 42299325
(1R)-1-(2-methoxyphenyl)-2-[(2-methylsulfanylpyrimidin-5-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 42299325) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is (1R)-1-(2-methoxyphenyl)-2-[(2-methylsulfanylpyrimidin-5-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-1-(2-methoxyphenyl)-2-[(2-methylsulfanylpyrimidin-5-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 42299325 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (1R)-1-(2-methoxyphenyl)-2-[(2-methylsulfanylpyrimidin-5-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | COc1ccccc1[C@@H]1c2[nH]c3ccccc3c2CCN1Cc1cnc(SC)nc1 |
| InChI | InChI=1S/C24H24N4OS/c1-29-21-10-6-4-8-19(21)23-22-18(17-7-3-5-9-20(17)27-22)11-12-28(23)15-16-13-25-24(30-2)26-14-16/h3-10,13-14,23,27H,11-12,15H2,1-2H3/t23-/m1/s1 |
| InChIKey | RGIKXJSANOSRTQ-HSZRJFAPSA-N |
| XLogP | 4.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|