C27H27FN2O3 — CID 29185313
2-[4-[[(1S)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol (PubChem CID 29185313) has the molecular formula C27H27FN2O3 and a molecular weight of 446.52 g/mol. Its IUPAC name is 2-[4-[[(1S)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol.
| Compound Name | 2-[4-[[(1S)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 29185313 |
| Molecular Formula | C27H27FN2O3 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-[4-[[(1S)-1-(2-fluoro-4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]phenoxy]ethanol |
| SMILES | COc1ccc([C@H]2c3[nH]c4ccccc4c3CCN2Cc2ccc(OCCO)cc2)c(F)c1 |
| InChI | InChI=1S/C27H27FN2O3/c1-32-20-10-11-23(24(28)16-20)27-26-22(21-4-2-3-5-25(21)29-26)12-13-30(27)17-18-6-8-19(9-7-18)33-15-14-31/h2-11,16,27,29,31H,12-15,17H2,1H3/t27-/m0/s1 |
| InChIKey | XPXPAQYHWZIMEM-MHZLTWQESA-N |
| XLogP | 4.83 |
| TPSA | 57.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|