C23H24N4S — CID 45218790
2-[(1-methylpyrazol-4-yl)methyl]-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 45218790) has the molecular formula C23H24N4S and a molecular weight of 388.54 g/mol. Its IUPAC name is 2-[(1-methylpyrazol-4-yl)methyl]-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[(1-methylpyrazol-4-yl)methyl]-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 45218790 |
| Molecular Formula | C23H24N4S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[(1-methylpyrazol-4-yl)methyl]-1-(4-methylsulfanylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CSc1ccc(C2c3[nH]c4ccccc4c3CCN2Cc2cnn(C)c2)cc1 |
| InChI | InChI=1S/C23H24N4S/c1-26-14-16(13-24-26)15-27-12-11-20-19-5-3-4-6-21(19)25-22(20)23(27)17-7-9-18(28-2)10-8-17/h3-10,13-14,23,25H,11-12,15H2,1-2H3 |
| InChIKey | XPTKEXDXFMFORE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|