C25H22N2O3S — CID 45239798
1-[5-[1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone (PubChem CID 45239798) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 1-[5-[1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[5-[1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 45239798 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1-[5-[1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]thiophen-2-yl]ethanone |
| SMILES | COc1ccccc1C1c2[nH]c3ccccc3c2CCN1C(=O)c1ccc(C(C)=O)s1 |
| InChI | InChI=1S/C25H22N2O3S/c1-15(28)21-11-12-22(31-21)25(29)27-14-13-17-16-7-3-5-9-19(16)26-23(17)24(27)18-8-4-6-10-20(18)30-2/h3-12,24,26H,13-14H2,1-2H3 |
| InChIKey | SHKCPVFMWQISDG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|