C27H24F2N2O3S — CID 44758871
[3-(difluoromethylsulfanyl)phenyl]-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 44758871) has the molecular formula C27H24F2N2O3S and a molecular weight of 494.56 g/mol. Its IUPAC name is [3-(difluoromethylsulfanyl)phenyl]-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | [3-(difluoromethylsulfanyl)phenyl]-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 44758871 |
| Molecular Formula | C27H24F2N2O3S |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [3-(difluoromethylsulfanyl)phenyl]-[1-(2,5-dimethoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | COc1ccc(OC)c(C2c3[nH]c4ccccc4c3CCN2C(=O)c2cccc(SC(F)F)c2)c1 |
| InChI | InChI=1S/C27H24F2N2O3S/c1-33-17-10-11-23(34-2)21(15-17)25-24-20(19-8-3-4-9-22(19)30-24)12-13-31(25)26(32)16-6-5-7-18(14-16)35-27(28)29/h3-11,14-15,25,27,30H,12-13H2,1-2H3 |
| InChIKey | ABLXTGFPCAJDQQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|