C24H19Cl3N2O3S — CID 98399485
[(1S)-6-methoxy-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3,4,5-trichlorothiophen-2-yl)methanone (PubChem CID 98399485) has the molecular formula C24H19Cl3N2O3S and a molecular weight of 521.85 g/mol. Its IUPAC name is [(1S)-6-methoxy-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3,4,5-trichlorothiophen-2-yl)methanone.
| Compound Name | [(1S)-6-methoxy-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3,4,5-trichlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 98399485 |
| Molecular Formula | C24H19Cl3N2O3S |
| Molecular Weight | 521.85 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | [(1S)-6-methoxy-1-(2-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3,4,5-trichlorothiophen-2-yl)methanone |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)c1sc(Cl)c(Cl)c1Cl)[C@H]3c1ccccc1OC |
| InChI | InChI=1S/C24H19Cl3N2O3S/c1-31-12-7-8-16-15(11-12)13-9-10-29(24(30)22-18(25)19(26)23(27)33-22)21(20(13)28-16)14-5-3-4-6-17(14)32-2/h3-8,11,21,28H,9-10H2,1-2H3/t21-/m0/s1 |
| InChIKey | PUCLUEXEHGUWSC-NRFANRHFSA-N |
| XLogP | 6.99 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.85 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|