C26H22ClN3O5 — CID 42556409
[(1R)-1-(4-chloro-3-nitrophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone (PubChem CID 42556409) has the molecular formula C26H22ClN3O5 and a molecular weight of 491.93 g/mol. Its IUPAC name is [(1R)-1-(4-chloro-3-nitrophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(1R)-1-(4-chloro-3-nitrophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 42556409 |
| Molecular Formula | C26H22ClN3O5 |
| Molecular Weight | 491.93 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | [(1R)-1-(4-chloro-3-nitrophenyl)-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CCc3c([nH]c4ccc(OC)cc34)[C@H]2c2ccc(Cl)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H22ClN3O5/c1-34-17-5-3-4-16(12-17)26(31)29-11-10-19-20-14-18(35-2)7-9-22(20)28-24(19)25(29)15-6-8-21(27)23(13-15)30(32)33/h3-9,12-14,25,28H,10-11H2,1-2H3/t25-/m1/s1 |
| InChIKey | NBBSSZJPIQQOHE-RUZDIDTESA-N |
| XLogP | 5.53 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.93 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|