C25H22N4O4 — CID 42556378
(1R)-6-methoxy-1-(4-nitrophenyl)-N-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 42556378) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is (1R)-6-methoxy-1-(4-nitrophenyl)-N-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | (1R)-6-methoxy-1-(4-nitrophenyl)-N-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42556378 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | (1R)-6-methoxy-1-(4-nitrophenyl)-N-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)Nc1ccccc1)[C@@H]3c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H22N4O4/c1-33-19-11-12-22-21(15-19)20-13-14-28(25(30)26-17-5-3-2-4-6-17)24(23(20)27-22)16-7-9-18(10-8-16)29(31)32/h2-12,15,24,27H,13-14H2,1H3,(H,26,30)/t24-/m1/s1 |
| InChIKey | LOPKCWHZTNLAFL-XMMPIXPASA-N |
| XLogP | 5.26 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|