C26H24BrN3O2 — CID 20920996
N-(2-bromophenyl)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 20920996) has the molecular formula C26H24BrN3O2 and a molecular weight of 490.40 g/mol. Its IUPAC name is N-(2-bromophenyl)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | N-(2-bromophenyl)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 20920996 |
| Molecular Formula | C26H24BrN3O2 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-(2-bromophenyl)-6-methoxy-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)Nc1ccccc1Br)C3c1ccc(C)cc1 |
| InChI | InChI=1S/C26H24BrN3O2/c1-16-7-9-17(10-8-16)25-24-19(20-15-18(32-2)11-12-22(20)28-24)13-14-30(25)26(31)29-23-6-4-3-5-21(23)27/h3-12,15,25,28H,13-14H2,1-2H3,(H,29,31) |
| InChIKey | OXJMINIEMLKEMA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|