C21H26N2O2 — CID 45231861
[5-[[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol (PubChem CID 45231861) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is [5-[[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol.
| Compound Name | [5-[[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 45231861 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | [5-[[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methyl]furan-2-yl]methanol |
| SMILES | CC(C)CC1c2[nH]c3ccccc3c2CCN1Cc1ccc(CO)o1 |
| InChI | InChI=1S/C21H26N2O2/c1-14(2)11-20-21-18(17-5-3-4-6-19(17)22-21)9-10-23(20)12-15-7-8-16(13-24)25-15/h3-8,14,20,22,24H,9-13H2,1-2H3 |
| InChIKey | MWIBYGLUVKLSAV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 52.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|