C23H31N3O2 — CID 126459931
1-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]piperidin-1-yl]ethanone (PubChem CID 126459931) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 126459931 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-[4-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbonyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(C(=O)N2CCc3c([nH]c4ccccc34)C2CC(C)C)CC1 |
| InChI | InChI=1S/C23H31N3O2/c1-15(2)14-21-22-19(18-6-4-5-7-20(18)24-22)10-13-26(21)23(28)17-8-11-25(12-9-17)16(3)27/h4-7,15,17,21,24H,8-14H2,1-3H3 |
| InChIKey | RBSWKKIHTADWND-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|